(Z)-3-hexen-1-yl decanoate 85554-69-4


product Name (Z)-3-hexenyl decanoate
Synonyms (Z)-3-Hexenyl decanoate; 3-Hexenyl decanoate; Decanoic acid, 3-hexenyl ester, (Z)-; (3Z)-hex-3-en-1-yl decanoate; (3E)-hex-3-en-1-yl decanoate
Molecular Formula C16H30O2
Molecular Weight 254.4082
InChI InChI=1/C16H30O2/c1-3-5-7-9-10-11-12-14-16(17)18-15-13-8-6-4-2/h6,8H,3-5,7,9-15H2,1-2H3/b8-6+
CAS Registry Number 85554-69-4
EINECS 287-601-3
Density 0.878g/cm3
Boiling point 326.4°C at 760 mmHg
Refractive index 1.45
Flash point 93.9°C