(Z)-3-hexen-1-yl valerate 56922-81-7


product Name (E)-hex-3-enyl valerate
Synonyms (E)-Hex-3-enyl valerate
Molecular Formula C11H20O2
Molecular Weight 184.277
InChI InChI=1/C11H20O2/c1-3-5-7-8-10-13-11(12)9-6-4-2/h5,7H,3-4,6,8-10H2,1-2H3/b7-5+
CAS Registry Number 56922-81-7
EINECS 260-443-2